CAS 1498716-91-8 is the registry number for 4-(3-Bromothiophene-2-carbonyl)morpholine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3-bromothiophene-2-carbonyl)morpholine-3-carboxylic acid (CAS 1498716-91-8) is a chemical compound with the molecular formula C10H10BrNO4S and a molecular weight of 320.16 g/mol. IUPAC name: 4-(3-bromothiophene-2-carbonyl)morpholine-3-carboxylic acid. InChIKey: VWERCZHZFXKEDP-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO4S |
|---|---|
| Molecular weight | 320.16 g/mol |
| IUPAC name | 4-(3-bromothiophene-2-carbonyl)morpholine-3-carboxylic acid |
| InChIKey | VWERCZHZFXKEDP-UHFFFAOYSA-N |
| SMILES | C1COCC(N1C(=O)C2=C(C=CS2)Br)C(=O)O |
Computed by PubChem (NCBI)