Products 1282218-14-7

CAS 1282218-14-7 appears in our catalog under these names: 5-(3-Methyl-5-isoxazolyl)-2-thiophenesulfonyl chloride, 95%, 5-(3-Methyl-5-isoxazolyl)-2-thiophenesulfonyl chloride, 95%, 95%, 5-(3-Methylisoxazol-5-yl)thiophene-2-sulfonyl chloride, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 5g.

Structural formula: {0} (CAS {1})

5-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride (CAS 1282218-14-7) is a chemical compound with the molecular formula C8H6ClNO3S2 and a molecular weight of 263.7 g/mol. IUPAC name: 5-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride. InChIKey: KYTGBJPEUYAGNH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClNO3S2
Molecular weight263.7 g/mol
IUPAC name5-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonyl chloride
InChIKeyKYTGBJPEUYAGNH-UHFFFAOYSA-N
SMILESCC1=NOC(=C1)C2=CC=C(S2)S(=O)(=O)Cl

Computed by PubChem (NCBI)