CAS 443955-56-4 appears in our catalog under these names: 3-Oxo-3,4-dihydro-2h-benzo[b][1,4]thiazine-6-sulfonyl chloride, 95%, 3-Oxo-3,4-dihydro-2H-1,4-benzothiazine-6-sulfonyl chloride, 3-Oxo-3,4-dihydro-2h-1,4-benzothiazine-6-sulfonyl chloride, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g, 100mg.
3-oxo-4H-1,4-benzothiazine-6-sulfonyl chloride (CAS 443955-56-4) is a chemical compound with the molecular formula C8H6ClNO3S2 and a molecular weight of 263.7 g/mol. IUPAC name: 3-oxo-4H-1,4-benzothiazine-6-sulfonyl chloride. InChIKey: FEXJVEZCIWUQMB-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO3S2 |
|---|---|
| Molecular weight | 263.7 g/mol |
| IUPAC name | 3-oxo-4H-1,4-benzothiazine-6-sulfonyl chloride |
| InChIKey | FEXJVEZCIWUQMB-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(S1)C=CC(=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)