CAS 1282484-31-4 is the registry number for 5-(Isoxazol-5-yl)-2-methylthiophene-3-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-5-(1,2-oxazol-5-yl)thiophene-3-sulfonyl chloride (CAS 1282484-31-4) is a chemical compound with the molecular formula C8H6ClNO3S2 and a molecular weight of 263.7 g/mol. IUPAC name: 2-methyl-5-(1,2-oxazol-5-yl)thiophene-3-sulfonyl chloride. InChIKey: BNKQSMWYZHDASO-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO3S2 |
|---|---|
| Molecular weight | 263.7 g/mol |
| IUPAC name | 2-methyl-5-(1,2-oxazol-5-yl)thiophene-3-sulfonyl chloride |
| InChIKey | BNKQSMWYZHDASO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(S1)C2=CC=NO2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)