CAS 878682-97-4 is the registry number for 3-Methyl-2-oxo-2,3-dihydro-1,3-benzothiazole-6-sulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 1g.
3-methyl-2-oxo-1,3-benzothiazole-6-sulfonyl chloride (CAS 878682-97-4) is a chemical compound with the molecular formula C8H6ClNO3S2 and a molecular weight of 263.7 g/mol. IUPAC name: 3-methyl-2-oxo-1,3-benzothiazole-6-sulfonyl chloride. InChIKey: LHPLJRSBDAYNOT-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO3S2 |
|---|---|
| Molecular weight | 263.7 g/mol |
| IUPAC name | 3-methyl-2-oxo-1,3-benzothiazole-6-sulfonyl chloride |
| InChIKey | LHPLJRSBDAYNOT-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)S(=O)(=O)Cl)SC1=O |
Computed by PubChem (NCBI)