CAS 128231-55-0 appears in our catalog under these names: 1–(4–tert–butylphenyl)hydrazine hydrochloride, (4-(tert-Butyl)phenyl)hydrazine hydrochloride, (4-(tert-Butyl)phenyl)hydrazine hydrochloride 95%, (4-(tert-Butyl)phenyl)hydrazine hydrochloride, 95%, 95%, (4-(tert-Butyl)phenyl)hydrazine hydrochloride, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 2g, 5g, 10g, 1000g, 250mg, 1g, 100g.
(4-tert-butylphenyl)hydrazine;hydrochloride (CAS 128231-55-0) is a chemical compound with the molecular formula C10H17ClN2 and a molecular weight of 200.71 g/mol. IUPAC name: (4-tert-butylphenyl)hydrazine;hydrochloride. InChIKey: VTESCYNPUGSWKG-UHFFFAOYSA-N.
| Molecular formula | C10H17ClN2 |
|---|---|
| Molecular weight | 200.71 g/mol |
| IUPAC name | (4-tert-butylphenyl)hydrazine;hydrochloride |
| InChIKey | VTESCYNPUGSWKG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)NN.Cl |
Computed by PubChem (NCBI)