Products 1282451-83-5
CAS 1282451-83-5 appears in our catalog under these names: PLpro/RBD-IN-1/ 100%, PLpro/RBD-IN-1, 2-[5-(pyridin-4-yl)-1,2,4-oxadiazol-3-yl]aniline. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 10 mg.
2-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)aniline (CAS 1282451-83-5) is a chemical compound with the molecular formula C13H10N4O and a molecular weight of 238.24 g/mol. IUPAC name: 2-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)aniline. InChIKey: JAUZELUMYXAVEN-UHFFFAOYSA-N.
| Molecular formula | C13H10N4O |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 2-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)aniline |
| InChIKey | JAUZELUMYXAVEN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NOC(=N2)C3=CC=NC=C3)N |
Computed by PubChem (NCBI)