CAS 947238-18-8 is the registry number for 3-Amino-2-(pyridin-3-yl)quinazolin-4(3H)-one. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.
3-amino-2-pyridin-3-ylquinazolin-4-one (CAS 947238-18-8) is a chemical compound with the molecular formula C13H10N4O and a molecular weight of 238.24 g/mol. IUPAC name: 3-amino-2-pyridin-3-ylquinazolin-4-one. InChIKey: AGTLDIYBFVTSBB-UHFFFAOYSA-N.
| Molecular formula | C13H10N4O |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 3-amino-2-pyridin-3-ylquinazolin-4-one |
| InChIKey | AGTLDIYBFVTSBB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C(=N2)C3=CN=CC=C3)N |
Computed by PubChem (NCBI)