CAS 1282502-23-1 appears in our catalog under these names: (1R,2S)-Tapentadol Hydrochloride (1mg/ml in Acetonitrile), (1R,2S)-Tapentadol Hydrochloride. Offered by: TRC. Available pack sizes: 1x1ml, 10mg.
3-[(2S,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenol;hydrochloride (CAS 1282502-23-1) is a chemical compound with the molecular formula C14H24ClNO and a molecular weight of 257.80 g/mol. IUPAC name: 3-[(2S,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenol;hydrochloride. InChIKey: ZELFLGGRLLOERW-GBWFEORMSA-N.
| Molecular formula | C14H24ClNO |
|---|---|
| Molecular weight | 257.80 g/mol |
| IUPAC name | 3-[(2S,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenol;hydrochloride |
| InChIKey | ZELFLGGRLLOERW-GBWFEORMSA-N |
| SMILES | CC[C@@H](C1=CC(=CC=C1)O)[C@H](C)CN(C)C.Cl |
Computed by PubChem (NCBI)