CAS 1384429-91-7 appears in our catalog under these names: 2-(2-Amino-3,3-dimethylbutoxy)-1,3-dimethylbenzene hydrochloride, 95%, 2-(2-Amino-3,3-dimethylbutoxy)-1,3-dimethylbenzene hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(2,6-dimethylphenoxy)-3,3-dimethylbutan-2-amine;hydrochloride (CAS 1384429-91-7) is a chemical compound with the molecular formula C14H24ClNO and a molecular weight of 257.80 g/mol. IUPAC name: 1-(2,6-dimethylphenoxy)-3,3-dimethylbutan-2-amine;hydrochloride. InChIKey: IRJJJVSXFHGISN-UHFFFAOYSA-N.
| Molecular formula | C14H24ClNO |
|---|---|
| Molecular weight | 257.80 g/mol |
| IUPAC name | 1-(2,6-dimethylphenoxy)-3,3-dimethylbutan-2-amine;hydrochloride |
| InChIKey | IRJJJVSXFHGISN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)OCC(C(C)(C)C)N.Cl |
Computed by PubChem (NCBI)