Products 175591-10-3

CAS 175591-10-3 is the registry number for (1S,2S)-Tapentadol Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 5mg, 10mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

3-[(2S,3S)-1-(dimethylamino)-2-methylpentan-3-yl]phenol;hydrochloride (CAS 175591-10-3) is a chemical compound with the molecular formula C14H24ClNO and a molecular weight of 257.80 g/mol. IUPAC name: 3-[(2S,3S)-1-(dimethylamino)-2-methylpentan-3-yl]phenol;hydrochloride. InChIKey: ZELFLGGRLLOERW-GGMFNZDASA-N.

Identity
Molecular formulaC14H24ClNO
Molecular weight257.80 g/mol
IUPAC name3-[(2S,3S)-1-(dimethylamino)-2-methylpentan-3-yl]phenol;hydrochloride
InChIKeyZELFLGGRLLOERW-GGMFNZDASA-N
SMILESCC[C@H](C1=CC(=CC=C1)O)[C@H](C)CN(C)C.Cl

Computed by PubChem (NCBI)