CAS 54034-16-1 is the registry number for 4-Amino-2,6-di-tert-butylphenol hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 5g.
4-amino-2,6-ditert-butylphenol;hydrochloride (CAS 54034-16-1) is a chemical compound with the molecular formula C14H24ClNO and a molecular weight of 257.80 g/mol. IUPAC name: 4-amino-2,6-ditert-butylphenol;hydrochloride. InChIKey: ZUIMNFHCXYKWGT-UHFFFAOYSA-N.
| Molecular formula | C14H24ClNO |
|---|---|
| Molecular weight | 257.80 g/mol |
| IUPAC name | 4-amino-2,6-ditert-butylphenol;hydrochloride |
| InChIKey | ZUIMNFHCXYKWGT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)N.Cl |
Computed by PubChem (NCBI)