Products 1282516-74-8
CAS 1282516-74-8 is the registry number for 9-bromo-5,6-dihydrobenzo[f]imidazo[1,2-d][1,4]oxazepine-2-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
9-bromo-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepine-2-carboxylic acid (CAS 1282516-74-8) is a chemical compound with the molecular formula C12H9BrN2O3 and a molecular weight of 309.11 g/mol. IUPAC name: 9-bromo-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepine-2-carboxylic acid. InChIKey: IRSCQONAQHCRLC-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2O3 |
|---|---|
| Molecular weight | 309.11 g/mol |
| IUPAC name | 9-bromo-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepine-2-carboxylic acid |
| InChIKey | IRSCQONAQHCRLC-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=CC(=C2)Br)C3=NC(=CN31)C(=O)O |
Computed by PubChem (NCBI)