Products 930652-81-6
CAS 930652-81-6 is the registry number for N-(Benzo[d][1,3]dioxol-5-yl)-4-bromo-1H-pyrrole-2-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1,3-benzodioxol-5-yl)-4-bromo-1H-pyrrole-2-carboxamide (CAS 930652-81-6) is a chemical compound with the molecular formula C12H9BrN2O3 and a molecular weight of 309.11 g/mol. IUPAC name: N-(1,3-benzodioxol-5-yl)-4-bromo-1H-pyrrole-2-carboxamide. InChIKey: MAFFBXUHTIODKA-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2O3 |
|---|---|
| Molecular weight | 309.11 g/mol |
| IUPAC name | N-(1,3-benzodioxol-5-yl)-4-bromo-1H-pyrrole-2-carboxamide |
| InChIKey | MAFFBXUHTIODKA-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)NC(=O)C3=CC(=CN3)Br |
Computed by PubChem (NCBI)