CAS 512809-29-9 is the registry number for 4-Formylphenyl 4-bromo-1-methyl-1H-pyrazole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(4-formylphenyl) 4-bromo-1-methylpyrazole-3-carboxylate (CAS 512809-29-9) is a chemical compound with the molecular formula C12H9BrN2O3 and a molecular weight of 309.11 g/mol. IUPAC name: (4-formylphenyl) 4-bromo-1-methylpyrazole-3-carboxylate. InChIKey: FKVYLLJHNLEMSF-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2O3 |
|---|---|
| Molecular weight | 309.11 g/mol |
| IUPAC name | (4-formylphenyl) 4-bromo-1-methylpyrazole-3-carboxylate |
| InChIKey | FKVYLLJHNLEMSF-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C(=O)OC2=CC=C(C=C2)C=O)Br |
Computed by PubChem (NCBI)