CAS 3067882-74-7 is the registry number for 3-(7-bromo-1,2-benzoxazol-3-yl)piperidine-2,6-dione, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
3-(7-bromo-1,2-benzoxazol-3-yl)piperidine-2,6-dione (CAS 3067882-74-7) is a chemical compound with the molecular formula C12H9BrN2O3 and a molecular weight of 309.11 g/mol. IUPAC name: 3-(7-bromo-1,2-benzoxazol-3-yl)piperidine-2,6-dione. InChIKey: BUCSVSUOYQEADI-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2O3 |
|---|---|
| Molecular weight | 309.11 g/mol |
| IUPAC name | 3-(7-bromo-1,2-benzoxazol-3-yl)piperidine-2,6-dione |
| InChIKey | BUCSVSUOYQEADI-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=NOC3=C2C=CC=C3Br |
Computed by PubChem (NCBI)