CAS 128253-31-6 appears in our catalog under these names: Veliflapon, 97%, BAY–X 1005, BAY-X 1005, 2-Cyclopentyl-2-(2-((4-formylquinolin-2-yl)methoxy)phenyl)acetic acid, 99.48%, 99.48%, Veliflapon, 99.31%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 10mM/1mL, 10 mg.
(2R)-2-cyclopentyl-2-[4-(quinolin-2-ylmethoxy)phenyl]acetic acid (CAS 128253-31-6) is a chemical compound with the molecular formula C23H23NO3 and a molecular weight of 361.4 g/mol. IUPAC name: (2R)-2-cyclopentyl-2-[4-(quinolin-2-ylmethoxy)phenyl]acetic acid. InChIKey: ZEYYDOLCHFETHQ-JOCHJYFZSA-N.
| Molecular formula | C23H23NO3 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | (2R)-2-cyclopentyl-2-[4-(quinolin-2-ylmethoxy)phenyl]acetic acid |
| InChIKey | ZEYYDOLCHFETHQ-JOCHJYFZSA-N |
| SMILES | C1CCC(C1)[C@H](C2=CC=C(C=C2)OCC3=NC4=CC=CC=C4C=C3)C(=O)O |
Computed by PubChem (NCBI)