Products 1951441-40-9

CAS 1951441-40-9 is the registry number for N-[3-(Benzyloxy)phenyl]anilinoacetic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 2-(N-(3-phenylmethoxyphenyl)anilino)acetate (CAS 1951441-40-9) is a chemical compound with the molecular formula C23H23NO3 and a molecular weight of 361.4 g/mol. IUPAC name: ethyl 2-(N-(3-phenylmethoxyphenyl)anilino)acetate. InChIKey: PAEUJZBUKPGFKH-UHFFFAOYSA-N.

Identity
Molecular formulaC23H23NO3
Molecular weight361.4 g/mol
IUPAC nameethyl 2-(N-(3-phenylmethoxyphenyl)anilino)acetate
InChIKeyPAEUJZBUKPGFKH-UHFFFAOYSA-N
SMILESCCOC(=O)CN(C1=CC=CC=C1)C2=CC(=CC=C2)OCC3=CC=CC=C3

Computed by PubChem (NCBI)