Products 128253-32-7
CAS 128253-32-7 appears in our catalog under these names: (S)–Veliflapon, (S)-Veliflapon, 99%, 99%, (S)-Veliflapon, 99.44%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 5mg, 25 mg, 50 mg, 100 mg, 5 mg.
(2S)-2-cyclopentyl-2-[4-(quinolin-2-ylmethoxy)phenyl]acetic acid (CAS 128253-32-7) is a chemical compound with the molecular formula C23H23NO3 and a molecular weight of 361.4 g/mol. IUPAC name: (2S)-2-cyclopentyl-2-[4-(quinolin-2-ylmethoxy)phenyl]acetic acid. InChIKey: ZEYYDOLCHFETHQ-QFIPXVFZSA-N.
| Molecular formula | C23H23NO3 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | (2S)-2-cyclopentyl-2-[4-(quinolin-2-ylmethoxy)phenyl]acetic acid |
| InChIKey | ZEYYDOLCHFETHQ-QFIPXVFZSA-N |
| SMILES | C1CCC(C1)[C@@H](C2=CC=C(C=C2)OCC3=NC4=CC=CC=C4C=C3)C(=O)O |
Computed by PubChem (NCBI)