CAS 4465-44-5 appears in our catalog under these names: Methyl trityl–L–serinate, N-(Triphenylmethyl)-L-serine Methyl Ester, >98.0%(GC)(T), Trt-Ser-OMe 95%, N-TRITYL-L-SERINE METHYL ESTER, 99%, (S)-Methyl 3-hydroxy-2-(tritylamino)propanoate, 95%, 95%. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 100g, 25g, 5g, 250mg, 1g, 10g, 500g, 1000g.
Methyl (2S)-3-hydroxy-2-(tritylamino)propanoate (CAS 4465-44-5) is a chemical compound with the molecular formula C23H23NO3 and a molecular weight of 361.4 g/mol. IUPAC name: methyl (2S)-3-hydroxy-2-(tritylamino)propanoate. InChIKey: LXAWQKKSNNYYEK-NRFANRHFSA-N.
| Molecular formula | C23H23NO3 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | methyl (2S)-3-hydroxy-2-(tritylamino)propanoate |
| InChIKey | LXAWQKKSNNYYEK-NRFANRHFSA-N |
| SMILES | COC(=O)[C@H](CO)NC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)