CAS 1283147-46-5 is the registry number for 7-Chloro-2-phenylthiazolo(5,4-d)pyrimidine. Offered by: Biosynth. Available pack sizes: 500mg.
7-chloro-2-phenyl-[1,3]thiazolo[5,4-d]pyrimidine (CAS 1283147-46-5) is a chemical compound with the molecular formula C11H6ClN3S and a molecular weight of 247.70 g/mol. IUPAC name: 7-chloro-2-phenyl-[1,3]thiazolo[5,4-d]pyrimidine. InChIKey: DODFZBFQALTZBM-UHFFFAOYSA-N.
| Molecular formula | C11H6ClN3S |
|---|---|
| Molecular weight | 247.70 g/mol |
| IUPAC name | 7-chloro-2-phenyl-[1,3]thiazolo[5,4-d]pyrimidine |
| InChIKey | DODFZBFQALTZBM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(S2)N=CN=C3Cl |
Computed by PubChem (NCBI)