CAS 1989659-69-9 is the registry number for 7-Chloro-3-phenyl-(1,2)thiazolo(4,5-d)pyrimidine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
7-chloro-3-phenyl-[1,2]thiazolo[4,5-d]pyrimidine (CAS 1989659-69-9) is a chemical compound with the molecular formula C11H6ClN3S and a molecular weight of 247.70 g/mol. IUPAC name: 7-chloro-3-phenyl-[1,2]thiazolo[4,5-d]pyrimidine. InChIKey: ZYOZOMVXVMXRND-UHFFFAOYSA-N.
| Molecular formula | C11H6ClN3S |
|---|---|
| Molecular weight | 247.70 g/mol |
| IUPAC name | 7-chloro-3-phenyl-[1,2]thiazolo[4,5-d]pyrimidine |
| InChIKey | ZYOZOMVXVMXRND-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NSC3=C2N=CN=C3Cl |
Computed by PubChem (NCBI)