Products 935844-56-7
CAS 935844-56-7 is the registry number for 4-Chloro-6-(pyridin-4-yl)thieno[3,2-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-6-pyridin-4-ylthieno[3,2-d]pyrimidine (CAS 935844-56-7) is a chemical compound with the molecular formula C11H6ClN3S and a molecular weight of 247.70 g/mol. IUPAC name: 4-chloro-6-pyridin-4-ylthieno[3,2-d]pyrimidine. InChIKey: UQIFLHPLCPJRAP-UHFFFAOYSA-N.
| Molecular formula | C11H6ClN3S |
|---|---|
| Molecular weight | 247.70 g/mol |
| IUPAC name | 4-chloro-6-pyridin-4-ylthieno[3,2-d]pyrimidine |
| InChIKey | UQIFLHPLCPJRAP-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=CC3=C(S2)C(=NC=N3)Cl |
Computed by PubChem (NCBI)