CAS 1339578-16-3 is the registry number for 5-(5-Chloro-1,3,4-thiadiazol-2-yl)quinoline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-chloro-5-quinolin-5-yl-1,3,4-thiadiazole (CAS 1339578-16-3) is a chemical compound with the molecular formula C11H6ClN3S and a molecular weight of 247.70 g/mol. IUPAC name: 2-chloro-5-quinolin-5-yl-1,3,4-thiadiazole. InChIKey: PFCOLYDJSQXWDH-UHFFFAOYSA-N.
| Molecular formula | C11H6ClN3S |
|---|---|
| Molecular weight | 247.70 g/mol |
| IUPAC name | 2-chloro-5-quinolin-5-yl-1,3,4-thiadiazole |
| InChIKey | PFCOLYDJSQXWDH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CC=NC2=C1)C3=NN=C(S3)Cl |
Computed by PubChem (NCBI)