CAS 1283707-34-5 is the registry number for 2-((5-Bromo-2-fluorophenyl)methyl)-3-hydroxypropanenitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[(5-bromo-2-fluorophenyl)methyl]-3-hydroxypropanenitrile (CAS 1283707-34-5) is a chemical compound with the molecular formula C10H9BrFNO and a molecular weight of 258.09 g/mol. IUPAC name: 2-[(5-bromo-2-fluorophenyl)methyl]-3-hydroxypropanenitrile. InChIKey: DNMHSYYYITXCBB-UHFFFAOYSA-N.
| Molecular formula | C10H9BrFNO |
|---|---|
| Molecular weight | 258.09 g/mol |
| IUPAC name | 2-[(5-bromo-2-fluorophenyl)methyl]-3-hydroxypropanenitrile |
| InChIKey | DNMHSYYYITXCBB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)CC(CO)C#N)F |
Computed by PubChem (NCBI)