CAS 1283953-42-3 is the registry number for Ethyl 3-(3,5-difluorophenyl)-2,2-dimethyl-3-oxopropanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 3-(3,5-difluorophenyl)-2,2-dimethyl-3-oxopropanoate (CAS 1283953-42-3) is a chemical compound with the molecular formula C13H14F2O3 and a molecular weight of 256.24 g/mol. IUPAC name: ethyl 3-(3,5-difluorophenyl)-2,2-dimethyl-3-oxopropanoate. InChIKey: BPUGKAZODMBOIG-UHFFFAOYSA-N.
| Molecular formula | C13H14F2O3 |
|---|---|
| Molecular weight | 256.24 g/mol |
| IUPAC name | ethyl 3-(3,5-difluorophenyl)-2,2-dimethyl-3-oxopropanoate |
| InChIKey | BPUGKAZODMBOIG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C)C(=O)C1=CC(=CC(=C1)F)F |
Computed by PubChem (NCBI)