Products 1283953-42-3

CAS 1283953-42-3 is the registry number for Ethyl 3-(3,5-difluorophenyl)-2,2-dimethyl-3-oxopropanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 3-(3,5-difluorophenyl)-2,2-dimethyl-3-oxopropanoate (CAS 1283953-42-3) is a chemical compound with the molecular formula C13H14F2O3 and a molecular weight of 256.24 g/mol. IUPAC name: ethyl 3-(3,5-difluorophenyl)-2,2-dimethyl-3-oxopropanoate. InChIKey: BPUGKAZODMBOIG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14F2O3
Molecular weight256.24 g/mol
IUPAC nameethyl 3-(3,5-difluorophenyl)-2,2-dimethyl-3-oxopropanoate
InChIKeyBPUGKAZODMBOIG-UHFFFAOYSA-N
SMILESCCOC(=O)C(C)(C)C(=O)C1=CC(=CC(=C1)F)F

Computed by PubChem (NCBI)