CAS 2813205-00-2 is the registry number for Benzyl 3,3-difluoro-2,2-dimethyl-4-oxobutanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl 3,3-difluoro-2,2-dimethyl-4-oxobutanoate (CAS 2813205-00-2) is a chemical compound with the molecular formula C13H14F2O3 and a molecular weight of 256.24 g/mol. IUPAC name: benzyl 3,3-difluoro-2,2-dimethyl-4-oxobutanoate. InChIKey: OHIBBKVZJAEQPT-UHFFFAOYSA-N.
| Molecular formula | C13H14F2O3 |
|---|---|
| Molecular weight | 256.24 g/mol |
| IUPAC name | benzyl 3,3-difluoro-2,2-dimethyl-4-oxobutanoate |
| InChIKey | OHIBBKVZJAEQPT-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)OCC1=CC=CC=C1)C(C=O)(F)F |
Computed by PubChem (NCBI)