CAS 203321-56-6 is the registry number for (R)-2-((R)-3,3-Difluorocyclopentyl)-2-hydroxy-2-phenylacetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetic acid (CAS 203321-56-6) is a chemical compound with the molecular formula C13H14F2O3 and a molecular weight of 256.24 g/mol. IUPAC name: (2R)-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetic acid. InChIKey: GPUGYUSBIRXKND-MFKMUULPSA-N.
| Molecular formula | C13H14F2O3 |
|---|---|
| Molecular weight | 256.24 g/mol |
| IUPAC name | (2R)-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetic acid |
| InChIKey | GPUGYUSBIRXKND-MFKMUULPSA-N |
| SMILES | C1CC(C[C@@H]1[C@@](C2=CC=CC=C2)(C(=O)O)O)(F)F |
Computed by PubChem (NCBI)