CAS 2893850-36-5 is the registry number for tert-Butyl 4-(2,2-difluoroacetyl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-(2,2-difluoroacetyl)benzoate (CAS 2893850-36-5) is a chemical compound with the molecular formula C13H14F2O3 and a molecular weight of 256.24 g/mol. IUPAC name: tert-butyl 4-(2,2-difluoroacetyl)benzoate. InChIKey: MMKJADFJIMDGBM-UHFFFAOYSA-N.
| Molecular formula | C13H14F2O3 |
|---|---|
| Molecular weight | 256.24 g/mol |
| IUPAC name | tert-butyl 4-(2,2-difluoroacetyl)benzoate |
| InChIKey | MMKJADFJIMDGBM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=C(C=C1)C(=O)C(F)F |
Computed by PubChem (NCBI)