CAS 1284173-40-5 appears in our catalog under these names: 3-Propan-2-yl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline, 95%, 3-Propan-2-yl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-propan-2-yl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline (CAS 1284173-40-5) is a chemical compound with the molecular formula C13H16F3N and a molecular weight of 243.27 g/mol. IUPAC name: 3-propan-2-yl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline. InChIKey: XUAVLHBJQNYFGJ-UHFFFAOYSA-N.
| Molecular formula | C13H16F3N |
|---|---|
| Molecular weight | 243.27 g/mol |
| IUPAC name | 3-propan-2-yl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline |
| InChIKey | XUAVLHBJQNYFGJ-UHFFFAOYSA-N |
| SMILES | CC(C)C1CC2=C(C=CC(=C2)C(F)(F)F)NC1 |
Computed by PubChem (NCBI)