CAS 1439900-12-5 is the registry number for (1-(3-(Trifluoromethyl)benzyl)cyclobutyl)methanamine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
[1-[[3-(trifluoromethyl)phenyl]methyl]cyclobutyl]methanamine (CAS 1439900-12-5) is a chemical compound with the molecular formula C13H16F3N and a molecular weight of 243.27 g/mol. IUPAC name: [1-[[3-(trifluoromethyl)phenyl]methyl]cyclobutyl]methanamine. InChIKey: WBJRZSUXDAIMOI-UHFFFAOYSA-N.
| Molecular formula | C13H16F3N |
|---|---|
| Molecular weight | 243.27 g/mol |
| IUPAC name | [1-[[3-(trifluoromethyl)phenyl]methyl]cyclobutyl]methanamine |
| InChIKey | WBJRZSUXDAIMOI-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(CC2=CC(=CC=C2)C(F)(F)F)CN |
Computed by PubChem (NCBI)