CAS 1384431-01-9 appears in our catalog under these names: 2-(2,3-Dimethylphenyl)-2-(trifluoromethyl)pyrrolidine, 95%, 2-(2,3-Dimethylphenyl)-2-(trifluoromethyl)pyrrolidine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(2,3-dimethylphenyl)-2-(trifluoromethyl)pyrrolidine (CAS 1384431-01-9) is a chemical compound with the molecular formula C13H16F3N and a molecular weight of 243.27 g/mol. IUPAC name: 2-(2,3-dimethylphenyl)-2-(trifluoromethyl)pyrrolidine. InChIKey: DGJPPOVWQBQCQA-UHFFFAOYSA-N.
| Molecular formula | C13H16F3N |
|---|---|
| Molecular weight | 243.27 g/mol |
| IUPAC name | 2-(2,3-dimethylphenyl)-2-(trifluoromethyl)pyrrolidine |
| InChIKey | DGJPPOVWQBQCQA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C2(CCCN2)C(F)(F)F)C |
Computed by PubChem (NCBI)