Products 1284425-70-2

CAS 1284425-70-2 is the registry number for 2-Isopropyl-5-(phenylthio)pyrimidine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-phenylsulfanyl-2-propan-2-ylpyrimidine-4-carboxylic acid (CAS 1284425-70-2) is a chemical compound with the molecular formula C14H14N2O2S and a molecular weight of 274.34 g/mol. IUPAC name: 5-phenylsulfanyl-2-propan-2-ylpyrimidine-4-carboxylic acid. InChIKey: HPBXSECKFMAAGS-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14N2O2S
Molecular weight274.34 g/mol
IUPAC name5-phenylsulfanyl-2-propan-2-ylpyrimidine-4-carboxylic acid
InChIKeyHPBXSECKFMAAGS-UHFFFAOYSA-N
SMILESCC(C)C1=NC=C(C(=N1)C(=O)O)SC2=CC=CC=C2

Computed by PubChem (NCBI)