Products 1284448-67-4
CAS 1284448-67-4 is the registry number for ISOPROPYL 4-(4-BROMOPHENYL)-4-OXOBUTANOATE, 97%. Offered by: Chemat. Available pack sizes: 5g, 10g, 25g.
Propan-2-yl 4-(4-bromophenyl)-4-oxobutanoate (CAS 1284448-67-4) is a chemical compound with the molecular formula C13H15BrO3 and a molecular weight of 299.16 g/mol. IUPAC name: propan-2-yl 4-(4-bromophenyl)-4-oxobutanoate. InChIKey: LWPBQEOAFIAOMO-UHFFFAOYSA-N.
| Molecular formula | C13H15BrO3 |
|---|---|
| Molecular weight | 299.16 g/mol |
| IUPAC name | propan-2-yl 4-(4-bromophenyl)-4-oxobutanoate |
| InChIKey | LWPBQEOAFIAOMO-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)CCC(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)