CAS 1285177-04-9 is the registry number for 5-(3,4-Dimethyl-5-isoxazolyl)-2-furansulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-(3,4-dimethyl-1,2-oxazol-5-yl)furan-2-sulfonyl chloride (CAS 1285177-04-9) is a chemical compound with the molecular formula C9H8ClNO4S and a molecular weight of 261.68 g/mol. IUPAC name: 5-(3,4-dimethyl-1,2-oxazol-5-yl)furan-2-sulfonyl chloride. InChIKey: ZDQKUWGNGCITNF-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO4S |
|---|---|
| Molecular weight | 261.68 g/mol |
| IUPAC name | 5-(3,4-dimethyl-1,2-oxazol-5-yl)furan-2-sulfonyl chloride |
| InChIKey | ZDQKUWGNGCITNF-UHFFFAOYSA-N |
| SMILES | CC1=C(ON=C1C)C2=CC=C(O2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)