Products 293741-60-3

CAS 293741-60-3 is the registry number for 2-Methyl-3-oxo-3,4-dihydro-2h-benzo[1,4]oxazine-6-sulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

2-methyl-3-oxo-4H-1,4-benzoxazine-6-sulfonyl chloride (CAS 293741-60-3) is a chemical compound with the molecular formula C9H8ClNO4S and a molecular weight of 261.68 g/mol. IUPAC name: 2-methyl-3-oxo-4H-1,4-benzoxazine-6-sulfonyl chloride. InChIKey: VDOUTDKFANTPPX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8ClNO4S
Molecular weight261.68 g/mol
IUPAC name2-methyl-3-oxo-4H-1,4-benzoxazine-6-sulfonyl chloride
InChIKeyVDOUTDKFANTPPX-UHFFFAOYSA-N
SMILESCC1C(=O)NC2=C(O1)C=CC(=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)