CAS 1383579-87-0 appears in our catalog under these names: 3-Methyl-2-oxo-3,4-dihydro-2H-1,3-benzoxazine-6-sulfonyl chloride, 95%, 3-Methyl-2-oxo-3,4-dihydro-2H-1,3-benzoxazine-6-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-methyl-2-oxo-4H-1,3-benzoxazine-6-sulfonyl chloride (CAS 1383579-87-0) is a chemical compound with the molecular formula C9H8ClNO4S and a molecular weight of 261.68 g/mol. IUPAC name: 3-methyl-2-oxo-4H-1,3-benzoxazine-6-sulfonyl chloride. InChIKey: KWWOYMZGHAYEAJ-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO4S |
|---|---|
| Molecular weight | 261.68 g/mol |
| IUPAC name | 3-methyl-2-oxo-4H-1,3-benzoxazine-6-sulfonyl chloride |
| InChIKey | KWWOYMZGHAYEAJ-UHFFFAOYSA-N |
| SMILES | CN1CC2=C(C=CC(=C2)S(=O)(=O)Cl)OC1=O |
Computed by PubChem (NCBI)