CAS 919091-52-4 is the registry number for 5-Oxo-2,3,4,5-tetrahydro-1,4-benzoxazepine-7-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-oxo-3,4-dihydro-2H-1,4-benzoxazepine-7-sulfonyl chloride (CAS 919091-52-4) is a chemical compound with the molecular formula C9H8ClNO4S and a molecular weight of 261.68 g/mol. IUPAC name: 5-oxo-3,4-dihydro-2H-1,4-benzoxazepine-7-sulfonyl chloride. InChIKey: ZGRKUHQSLAKKEJ-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO4S |
|---|---|
| Molecular weight | 261.68 g/mol |
| IUPAC name | 5-oxo-3,4-dihydro-2H-1,4-benzoxazepine-7-sulfonyl chloride |
| InChIKey | ZGRKUHQSLAKKEJ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2)S(=O)(=O)Cl)C(=O)N1 |
Computed by PubChem (NCBI)