CAS 1286101-71-0 appears in our catalog under these names: 4-Fluoroephedrone-d3 Hydrochloride, 4-Fluoroephedrone-d3 Hydrochloride (1.0mg/ml in Acetonitrile). Offered by: TRC. Available pack sizes: 2,5mg, 25mg, 1x1ml.
3-[(4-methoxyphenyl)methylidene]-2-benzofuran-1-one (CAS 1286101-71-0) is a chemical compound with the molecular formula C16H12O3 and a molecular weight of 252.26 g/mol. IUPAC name: 3-[(4-methoxyphenyl)methylidene]-2-benzofuran-1-one. InChIKey: XBPLURLJIACOAL-UHFFFAOYSA-N.
| Molecular formula | C16H12O3 |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | 3-[(4-methoxyphenyl)methylidene]-2-benzofuran-1-one |
| InChIKey | XBPLURLJIACOAL-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C=C2C3=CC=CC=C3C(=O)O2 |
Computed by PubChem (NCBI)