CAS 1286129-04-1 appears in our catalog under these names: Fenoterol–d6 hydrobromide, Fenoterol-d6 Hydrobromide, Fenoterol-d6 HBr (propyl-d6-amino) (mixture of diastereomers), 97 atom % D, min 97% Chemical Purity, Fenoterol-d6 (hydrobromide), 98.02%. Offered by: GLPBio, Chemat Brand, TRC, CDN, Biosynth. Available pack sizes: 1mg, on request, 10mg, 0,01g, 0,005g, 2mg, 5mg, 1 mg.
5-[2-[[1,1,1,2,3,3-hexadeuterio-3-(4-hydroxyphenyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,3-diol;hydrobromide (CAS 1286129-04-1) is a chemical compound with the molecular formula C17H22BrNO4 and a molecular weight of 390.3 g/mol. IUPAC name: 5-[2-[[1,1,1,2,3,3-hexadeuterio-3-(4-hydroxyphenyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,3-diol;hydrobromide. InChIKey: SGZRQMALQBXAIQ-JOJSIGTQSA-N.
| Molecular formula | C17H22BrNO4 |
|---|---|
| Molecular weight | 390.3 g/mol |
| IUPAC name | 5-[2-[[1,1,1,2,3,3-hexadeuterio-3-(4-hydroxyphenyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,3-diol;hydrobromide |
| InChIKey | SGZRQMALQBXAIQ-JOJSIGTQSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])C1=CC=C(C=C1)O)NCC(C2=CC(=CC(=C2)O)O)O.Br |
Computed by PubChem (NCBI)