CAS 959579-70-5 is the registry number for Boc-(r)-alpha-(3-bromo-benzyl)-proline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2R)-2-[(3-bromophenyl)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 959579-70-5) is a chemical compound with the molecular formula C17H22BrNO4 and a molecular weight of 384.3 g/mol. IUPAC name: (2R)-2-[(3-bromophenyl)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: DSGWYYBWPWHDEU-QGZVFWFLSA-N.
| Molecular formula | C17H22BrNO4 |
|---|---|
| Molecular weight | 384.3 g/mol |
| IUPAC name | (2R)-2-[(3-bromophenyl)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | DSGWYYBWPWHDEU-QGZVFWFLSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@]1(CC2=CC(=CC=C2)Br)C(=O)O |
Computed by PubChem (NCBI)