CAS 38964-10-2 appears in our catalog under these names: Fenoterol Impurity 1(Fenoterol EP Impurity A), (R*,S*)-(±)-Fenoterol Hydrobromide, >95% (HPLC). Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
5-[(1R)-1-hydroxy-2-[[(2S)-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]benzene-1,3-diol;hydrobromide (CAS 38964-10-2) is a chemical compound with the molecular formula C17H22BrNO4 and a molecular weight of 384.3 g/mol. IUPAC name: 5-[(1R)-1-hydroxy-2-[[(2S)-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]benzene-1,3-diol;hydrobromide. InChIKey: SGZRQMALQBXAIQ-USSZGJRJSA-N.
| Molecular formula | C17H22BrNO4 |
|---|---|
| Molecular weight | 384.3 g/mol |
| IUPAC name | 5-[(1R)-1-hydroxy-2-[[(2S)-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]benzene-1,3-diol;hydrobromide |
| InChIKey | SGZRQMALQBXAIQ-USSZGJRJSA-N |
| SMILES | C[C@@H](CC1=CC=C(C=C1)O)NC[C@@H](C2=CC(=CC(=C2)O)O)O.Br |
Computed by PubChem (NCBI)