CAS 895525-73-2 appears in our catalog under these names: tert-Butyl 6-bromo-4h-spiro[benzo[d][1,3]dioxine-2,4'-piperidine]-1'-carboxylate, 97%, tert-Butyl 6-bromo-4H-spiro[benzo[d][1,3]dioxine-2,4'-piperidine]-1'-carboxylate, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
Tert-butyl 6-bromospiro[4H-1,3-benzodioxine-2,4'-piperidine]-1'-carboxylate (CAS 895525-73-2) is a chemical compound with the molecular formula C17H22BrNO4 and a molecular weight of 384.3 g/mol. IUPAC name: tert-butyl 6-bromospiro[4H-1,3-benzodioxine-2,4'-piperidine]-1'-carboxylate. InChIKey: YKOKNSPJTCUZOQ-UHFFFAOYSA-N.
| Molecular formula | C17H22BrNO4 |
|---|---|
| Molecular weight | 384.3 g/mol |
| IUPAC name | tert-butyl 6-bromospiro[4H-1,3-benzodioxine-2,4'-piperidine]-1'-carboxylate |
| InChIKey | YKOKNSPJTCUZOQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)OCC3=C(O2)C=CC(=C3)Br |
Computed by PubChem (NCBI)