CAS 1286208-71-6 is the registry number for (R)-1-(4-Nitrobenzyl)pyrrolidin-3-amine dihydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
(3R)-1-[(4-nitrophenyl)methyl]pyrrolidin-3-amine;dihydrochloride (CAS 1286208-71-6) is a chemical compound with the molecular formula C11H17Cl2N3O2 and a molecular weight of 294.17 g/mol. IUPAC name: (3R)-1-[(4-nitrophenyl)methyl]pyrrolidin-3-amine;dihydrochloride. InChIKey: AXBGSYZYMVZKJU-YQFADDPSSA-N.
| Molecular formula | C11H17Cl2N3O2 |
|---|---|
| Molecular weight | 294.17 g/mol |
| IUPAC name | (3R)-1-[(4-nitrophenyl)methyl]pyrrolidin-3-amine;dihydrochloride |
| InChIKey | AXBGSYZYMVZKJU-YQFADDPSSA-N |
| SMILES | C1CN(C[C@@H]1N)CC2=CC=C(C=C2)[N+](=O)[O-].Cl.Cl |
Computed by PubChem (NCBI)