CAS 1443981-19-8 is the registry number for Ethyl 6-(3-aminoazetidin-1-yl)pyridine-3-carboxylate dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 6-(3-aminoazetidin-1-yl)pyridine-3-carboxylate;dihydrochloride (CAS 1443981-19-8) is a chemical compound with the molecular formula C11H17Cl2N3O2 and a molecular weight of 294.17 g/mol. IUPAC name: ethyl 6-(3-aminoazetidin-1-yl)pyridine-3-carboxylate;dihydrochloride. InChIKey: GGDKWARRRLJPFJ-UHFFFAOYSA-N.
| Molecular formula | C11H17Cl2N3O2 |
|---|---|
| Molecular weight | 294.17 g/mol |
| IUPAC name | ethyl 6-(3-aminoazetidin-1-yl)pyridine-3-carboxylate;dihydrochloride |
| InChIKey | GGDKWARRRLJPFJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(C=C1)N2CC(C2)N.Cl.Cl |
Computed by PubChem (NCBI)