CAS 1354952-11-6 appears in our catalog under these names: 2-(4-Aminopiperidin-1-yl)pyridine-4-carboxylic acid dihydrochloride, 98%, 2-(4-Aminopiperidin-1-yl)pyridine-4-carboxylic acid dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(4-aminopiperidin-1-yl)pyridine-4-carboxylic acid;dihydrochloride (CAS 1354952-11-6) is a chemical compound with the molecular formula C11H17Cl2N3O2 and a molecular weight of 294.17 g/mol. IUPAC name: 2-(4-aminopiperidin-1-yl)pyridine-4-carboxylic acid;dihydrochloride. InChIKey: ASXLGCSQVDTGFC-UHFFFAOYSA-N.
| Molecular formula | C11H17Cl2N3O2 |
|---|---|
| Molecular weight | 294.17 g/mol |
| IUPAC name | 2-(4-aminopiperidin-1-yl)pyridine-4-carboxylic acid;dihydrochloride |
| InChIKey | ASXLGCSQVDTGFC-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N)C2=NC=CC(=C2)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)