CAS 827614-55-1 appears in our catalog under these names: 1-(3-Nitrobenzyl)piperazine dihydrochloride, 1-(3-Nitrobenzyl)piperazine dihydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 1g, 10g, 5g.
1-[(3-nitrophenyl)methyl]piperazine;dihydrochloride (CAS 827614-55-1) is a chemical compound with the molecular formula C11H17Cl2N3O2 and a molecular weight of 294.17 g/mol. IUPAC name: 1-[(3-nitrophenyl)methyl]piperazine;dihydrochloride. InChIKey: BGYFKQBZFDFBMO-UHFFFAOYSA-N.
| Molecular formula | C11H17Cl2N3O2 |
|---|---|
| Molecular weight | 294.17 g/mol |
| IUPAC name | 1-[(3-nitrophenyl)methyl]piperazine;dihydrochloride |
| InChIKey | BGYFKQBZFDFBMO-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=CC(=CC=C2)[N+](=O)[O-].Cl.Cl |
Computed by PubChem (NCBI)