Products 1286215-09-5
CAS 1286215-09-5 is the registry number for 3-Chloro-N-(1-(N'-hydroxycarbamimidoyl)-1-methylethyl)benzamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-[(1Z)-1-amino-1-hydroxyimino-2-methylpropan-2-yl]-3-chlorobenzamide (CAS 1286215-09-5) is a chemical compound with the molecular formula C11H14ClN3O2 and a molecular weight of 255.70 g/mol. IUPAC name: N-[(1Z)-1-amino-1-hydroxyimino-2-methylpropan-2-yl]-3-chlorobenzamide. InChIKey: BQPUUXXJKSWMNA-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O2 |
|---|---|
| Molecular weight | 255.70 g/mol |
| IUPAC name | N-[(1Z)-1-amino-1-hydroxyimino-2-methylpropan-2-yl]-3-chlorobenzamide |
| InChIKey | BQPUUXXJKSWMNA-UHFFFAOYSA-N |
| SMILES | CC(C)(/C(=N/O)/N)NC(=O)C1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)