CAS 1286586-83-1 appears in our catalog under these names: Norketamine-d4, >95% (HPLC), Norketamine-d4 (1.0mg/ml in Acetonitrile). Offered by: TRC. Available pack sizes: 10mg, 1mg, 1x1ml.
2-amino-2-(2-chloro-3,4,5,6-tetradeuteriophenyl)cyclohexan-1-one (CAS 1286586-83-1) is a chemical compound with the molecular formula C12H14ClNO and a molecular weight of 227.72 g/mol. IUPAC name: 2-amino-2-(2-chloro-3,4,5,6-tetradeuteriophenyl)cyclohexan-1-one. InChIKey: BEQZHFIKTBVCAU-NMRLXUNGSA-N.
| Molecular formula | C12H14ClNO |
|---|---|
| Molecular weight | 227.72 g/mol |
| IUPAC name | 2-amino-2-(2-chloro-3,4,5,6-tetradeuteriophenyl)cyclohexan-1-one |
| InChIKey | BEQZHFIKTBVCAU-NMRLXUNGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C2(CCCCC2=O)N)Cl)[2H])[2H] |
Computed by PubChem (NCBI)