CAS 1914951-38-4 is the registry number for Norketamine-d8. Offered by: TRC. Available pack sizes: 25mg.
2-amino-2-(2-chlorophenyl)-3,3,4,4,5,5,6,6-octadeuteriocyclohexan-1-one (CAS 1914951-38-4) is a chemical compound with the molecular formula C12H14ClNO and a molecular weight of 231.75 g/mol. IUPAC name: 2-amino-2-(2-chlorophenyl)-3,3,4,4,5,5,6,6-octadeuteriocyclohexan-1-one. InChIKey: BEQZHFIKTBVCAU-IFBDEUHTSA-N.
| Molecular formula | C12H14ClNO |
|---|---|
| Molecular weight | 231.75 g/mol |
| IUPAC name | 2-amino-2-(2-chlorophenyl)-3,3,4,4,5,5,6,6-octadeuteriocyclohexan-1-one |
| InChIKey | BEQZHFIKTBVCAU-IFBDEUHTSA-N |
| SMILES | [2H]C1(C(=O)C(C(C(C1([2H])[2H])([2H])[2H])([2H])[2H])(C2=CC=CC=C2Cl)N)[2H] |
Computed by PubChem (NCBI)